cas: 1542-36-5 — see every product listed under this CAS number, including other names
2,5-Difluoro-4-nitroaniline, 98% (CAS 1542-36-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg, 100g. Offered by: Combi-blocks, Fluorochem, Ambeed.
| brand | Combi-blocks |
|---|---|
| catalog number | AN-3538-10g |
| cas | 1542-36-5 |
| size | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1101.71 Pln | |
| Fluorochem | 10g | 1664.02 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1065.69 Pln | |
| Ambeed | 10g | 1610.81 Pln | |
| Ambeed | 25g | 3168.31 Pln | |
| Ambeed | 100g | 7696.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,5-difluoro-4-nitroaniline (CAS 1542-36-5) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 2,5-difluoro-4-nitroaniline. InChIKey: IBGGCVMFSJQOID-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,5-difluoro-4-nitroaniline |
| InChIKey | IBGGCVMFSJQOID-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])F)N |
Computed by PubChem (NCBI)