cas: 306936-15-2 — see every product listed under this CAS number, including other names
2,5-Dimethyl-1-(pyridin-4-ylmethyl)-1H-pyrrole-3-carboxylic acid, 97% (CAS 306936-15-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | SP00292DA |
| cas | 306936-15-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 453.59 Pln | |
| Thermo Scientific | 5g | 1435.61 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2,5-dimethyl-1-(pyridin-4-ylmethyl)pyrrole-3-carboxylic acid (CAS 306936-15-2) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 2,5-dimethyl-1-(pyridin-4-ylmethyl)pyrrole-3-carboxylic acid. InChIKey: IHQUENCAKSKBOG-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 2,5-dimethyl-1-(pyridin-4-ylmethyl)pyrrole-3-carboxylic acid |
| InChIKey | IHQUENCAKSKBOG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1CC2=CC=NC=C2)C)C(=O)O |
Computed by PubChem (NCBI)