cas: 55312-97-5 — see every product listed under this CAS number, including other names
2,5-Dimethylphenylacetyl chloride 99% GC (CAS 55312-97-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A233697-5g |
| cas | 55312-97-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 565.06 Pln |
| purity | 99% GC |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A233697 |
2-(2,5-dimethylphenyl)acetyl chloride (CAS 55312-97-5) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)acetyl chloride. InChIKey: PZRANTBLOIKHJY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)acetyl chloride |
| InChIKey | PZRANTBLOIKHJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CC(=O)Cl |
Computed by PubChem (NCBI)