cas: 1807518-72-4 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 3-(2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)ethoxy)propanoate, 97%, 97% (CAS 1807518-72-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I18R-100mg |
| cas | 1807518-72-4 |
| size | 100mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 500mg | 626.00 Pln | |
| Chemat | 1g | 741.20 Pln | |
| Chemat | 5g | 1758.80 Pln | |
| Chemat | 10g | 3146.00 Pln | |
| Chemat | 25g | 6405.20 Pln | |
| Chemat | 50g | 7437.20 Pln | |
| Chemat | 100g | 13346.00 Pln | |
| Chemat | 250g | 23685.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate (CAS 1807518-72-4) is a chemical compound with the molecular formula C13H14N2O7 and a molecular weight of 310.26 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate. InChIKey: AMRJPIJPLBUEHO-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O7 |
|---|---|
| Molecular weight | 310.26 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate |
| InChIKey | AMRJPIJPLBUEHO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)