cas: 1807518-72-4 — see every product listed under this CAS number, including other names
Mal-PEG1-NHS ester (CAS 1807518-72-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 250mg. Offered by: TargetMol, Biosynth.
| brand | TargetMol |
|---|---|
| catalog number | T15976-5mg |
| cas | 1807518-72-4 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 432.54 Pln | |
| TargetMol | 10mg | 532.05 Pln | |
| TargetMol | 25mg | 810.99 Pln | |
| TargetMol | 50mg | 1242.54 Pln | |
| TargetMol | 100mg | 1873.65 Pln | |
| TargetMol | 200mg | 2736.74 Pln | |
| Biosynth | 500mg | price on request | |
| Biosynth | 250mg | price on request |
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
(2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate (CAS 1807518-72-4) is a chemical compound with the molecular formula C13H14N2O7 and a molecular weight of 310.26 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate. InChIKey: AMRJPIJPLBUEHO-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O7 |
|---|---|
| Molecular weight | 310.26 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate |
| InChIKey | AMRJPIJPLBUEHO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)