cas: 1807518-72-4 — see every product listed under this CAS number, including other names
Mal-PEG1-NHS ester, 98% (CAS 1807518-72-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F986413-100MG |
| cas | 1807518-72-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 1g | 1783.76 Pln | |
| Fluorochem | 5g | 6454.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate (CAS 1807518-72-4) is a chemical compound with the molecular formula C13H14N2O7 and a molecular weight of 310.26 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate. InChIKey: AMRJPIJPLBUEHO-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O7 |
|---|---|
| Molecular weight | 310.26 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate |
| InChIKey | AMRJPIJPLBUEHO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)