cas: 1807518-72-4 — see every product listed under this CAS number, including other names
Mal-PEG1-NHS ester, 99.63% (CAS 1807518-72-4) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 100 mg, 5 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-126886-1 g |
| cas | 1807518-72-4 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 2112.28 Pln | |
| MedChemExpress | 100 mg | 672.64 Pln | |
| MedChemExpress | 5 g | 7485.38 Pln | |
| MedChemExpress | 250 mg | 1030.22 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.63% |
(2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate (CAS 1807518-72-4) is a chemical compound with the molecular formula C13H14N2O7 and a molecular weight of 310.26 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate. InChIKey: AMRJPIJPLBUEHO-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O7 |
|---|---|
| Molecular weight | 310.26 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate |
| InChIKey | AMRJPIJPLBUEHO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)