cas: 1807518-72-4 — see every product listed under this CAS number, including other names
Mal-PEG1-NHS ester 97% (CAS 1807518-72-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A741387-100mg |
| cas | 1807518-72-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 909.94 Pln | |
| Ambeed | 1g | 1877.81 Pln | |
| Ambeed | 5g | 6772.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A741387 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate (CAS 1807518-72-4) is a chemical compound with the molecular formula C13H14N2O7 and a molecular weight of 310.26 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate. InChIKey: AMRJPIJPLBUEHO-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O7 |
|---|---|
| Molecular weight | 310.26 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoate |
| InChIKey | AMRJPIJPLBUEHO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)