cas: 84271-78-3 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 3-(acetylthio)propanoate 95% (CAS 84271-78-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A715742-100mg |
| cas | 84271-78-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 698.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A715742 |
(2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate (CAS 84271-78-3) is a chemical compound with the molecular formula C9H11NO5S and a molecular weight of 245.25 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate. InChIKey: ZRTJVRDXVSDKPX-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5S |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate |
| InChIKey | ZRTJVRDXVSDKPX-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)