cas: 84271-78-3 — see every product listed under this CAS number, including other names
2,5-DIOXOPYRROLIDIN-1-YL 3-(ACETYLTHIO)PROPANOATE, 95% (CAS 84271-78-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F390287-250MG |
| cas | 84271-78-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 1216.26 Pln | |
| Fluorochem | 10g | 2372.10 Pln | |
| Fluorochem | 25g | 5850.04 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate (CAS 84271-78-3) is a chemical compound with the molecular formula C9H11NO5S and a molecular weight of 245.25 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate. InChIKey: ZRTJVRDXVSDKPX-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5S |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate |
| InChIKey | ZRTJVRDXVSDKPX-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)