cas: 84271-78-3 — see every product listed under this CAS number, including other names
3-(Acetylthio)propionic acid N-succinimidyl ester, 99.68% (CAS 84271-78-3) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 10 g, 500 mg, 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W013976-100 mg |
| cas | 84271-78-3 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 263.96 Pln | |
| MedChemExpress | 10 g | 2650.98 Pln | |
| MedChemExpress | 500 mg | 505.45 Pln | |
| MedChemExpress | 1 g | 742.30 Pln | |
| MedChemExpress | 5 g | 1703.60 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.68% |
(2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate (CAS 84271-78-3) is a chemical compound with the molecular formula C9H11NO5S and a molecular weight of 245.25 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate. InChIKey: ZRTJVRDXVSDKPX-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5S |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate |
| InChIKey | ZRTJVRDXVSDKPX-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)