cas: 84271-78-3 — see every product listed under this CAS number, including other names
Acetic 2-(2,5-dioxopyrrolidin-1-yl)propanoic thioanhydride, 98%, 98% (CAS 84271-78-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TCK-100mg |
| cas | 84271-78-3 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1658.00 Pln | |
| Chemat | 10g | 2963.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate (CAS 84271-78-3) is a chemical compound with the molecular formula C9H11NO5S and a molecular weight of 245.25 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate. InChIKey: ZRTJVRDXVSDKPX-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5S |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate |
| InChIKey | ZRTJVRDXVSDKPX-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)