2,5-Dioxopyrrolidin-1-yl 4-chlorobenzoate, 95%
cas: 68388-09-0 — see every product listed under this CAS number, including other names
2,5-Dioxopyrrolidin-1-yl 4-chlorobenzoate, 95% (CAS 68388-09-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1556545-100mg |
| cas | 68388-09-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 720.81 Pln | |
| Ambeed | 1g | 1816.62 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1264.40 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 708.66 Pln | |
| BLDpharm | 1g | 1786.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2,5-dioxopyrrolidin-1-yl) 4-chlorobenzoate (CAS 68388-09-0) is a chemical compound with the molecular formula C11H8ClNO4 and a molecular weight of 253.64 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-chlorobenzoate. InChIKey: NWCJAIZMANMQOO-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO4 |
|---|---|
| Molecular weight | 253.64 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-chlorobenzoate |
| InChIKey | NWCJAIZMANMQOO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)