CAS 68388-08-9 is the registry number for 2,5-Dioxopyrrolidin-1-yl 2-chlorobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,5-dioxopyrrolidin-1-yl) 2-chlorobenzoate (CAS 68388-08-9) is a chemical compound with the molecular formula C11H8ClNO4 and a molecular weight of 253.64 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-chlorobenzoate. InChIKey: CZQOBTJLBSVYMC-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO4 |
|---|---|
| Molecular weight | 253.64 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-chlorobenzoate |
| InChIKey | CZQOBTJLBSVYMC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)