Products 120716-95-2
CAS 120716-95-2 appears in our catalog under these names: 3-(Carboxymethyl)-5-chloro-1H-indole-2-carboxylic acid, 95%, 95%, 3-(Carboxymethyl)-5-chloro-1h-indole-2-carboxylic acid, 95%, 3–(Carboxymethyl)–5–chloro–1H–indole–2–carboxylic acid, 3-(Carboxymethyl)-5-chloro-1H-indole-2-carboxylic acid, 98%. Offered by: Chemat, Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-(carboxymethyl)-5-chloro-1H-indole-2-carboxylic acid (CAS 120716-95-2) is a chemical compound with the molecular formula C11H8ClNO4 and a molecular weight of 253.64 g/mol. IUPAC name: 3-(carboxymethyl)-5-chloro-1H-indole-2-carboxylic acid. InChIKey: LRXDFQDRJSDXHF-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO4 |
|---|---|
| Molecular weight | 253.64 g/mol |
| IUPAC name | 3-(carboxymethyl)-5-chloro-1H-indole-2-carboxylic acid |
| InChIKey | LRXDFQDRJSDXHF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=C(N2)C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)