Products 2006277-75-2
CAS 2006277-75-2 is the registry number for 3-[(4-Chlorophenyl)(hydroxy)methyl]isoxazole-4-carboxylicAcid, >95%. Offered by: Chemat. Available pack sizes: 100mg.
3-[(4-chlorophenyl)-hydroxymethyl]-1,2-oxazole-4-carboxylic acid (CAS 2006277-75-2) is a chemical compound with the molecular formula C11H8ClNO4 and a molecular weight of 253.64 g/mol. IUPAC name: 3-[(4-chlorophenyl)-hydroxymethyl]-1,2-oxazole-4-carboxylic acid. InChIKey: GCFNTLRMFUKTTR-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO4 |
|---|---|
| Molecular weight | 253.64 g/mol |
| IUPAC name | 3-[(4-chlorophenyl)-hydroxymethyl]-1,2-oxazole-4-carboxylic acid |
| InChIKey | GCFNTLRMFUKTTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=NOC=C2C(=O)O)O)Cl |
Computed by PubChem (NCBI)