CAS 68388-09-0 appears in our catalog under these names: 2,5-Dioxopyrrolidin-1-yl 4-chlorobenzoate, 95%, 95%, 2,5-Dioxopyrrolidin-1-yl 4-chlorobenzoate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2,5-dioxopyrrolidin-1-yl) 4-chlorobenzoate (CAS 68388-09-0) is a chemical compound with the molecular formula C11H8ClNO4 and a molecular weight of 253.64 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-chlorobenzoate. InChIKey: NWCJAIZMANMQOO-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO4 |
|---|---|
| Molecular weight | 253.64 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-chlorobenzoate |
| InChIKey | NWCJAIZMANMQOO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)