2,5-Dipropoxyterephthalaldehyde, 98%
cas: 245116-57-8 — see every product listed under this CAS number, including other names
2,5-Dipropoxyterephthalaldehyde, 98% (CAS 245116-57-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1193170-100mg |
| cas | 245116-57-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 3446.44 Pln | |
| BLDpharm | 100mg | 192.18 Pln | |
| BLDpharm | 250mg | 264.38 Pln | |
| BLDpharm | 1g | 803.08 Pln | |
| BLDpharm | 5g | 3707.61 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 500mg | 366.80 Pln | |
| Chemat | 1g | 554.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2,5-dipropoxyterephthalaldehyde (CAS 245116-57-8) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: 2,5-dipropoxyterephthalaldehyde. InChIKey: IYVCKZLBCVNHFV-UHFFFAOYSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 2,5-dipropoxyterephthalaldehyde |
| InChIKey | IYVCKZLBCVNHFV-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC(=C(C=C1C=O)OCCC)C=O |
Computed by PubChem (NCBI)