cas: 15644-93-6 — see every product listed under this CAS number, including other names
2,6,8-Trimethylquinolin-4-ol, 99%, 99% (CAS 15644-93-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ANWJ-100mg |
| cas | 15644-93-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1067.60 Pln | |
| Chemat | 5g | 3616.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2,6,8-trimethyl-1H-quinolin-4-one (CAS 15644-93-6) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 2,6,8-trimethyl-1H-quinolin-4-one. InChIKey: HGONRXDUFLRKDC-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2,6,8-trimethyl-1H-quinolin-4-one |
| InChIKey | HGONRXDUFLRKDC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=O)C=C(N2)C)C |
Computed by PubChem (NCBI)