CAS 23913-55-5 appears in our catalog under these names: 2-Amino-1-(1-naphthyl)ethanol, 95%, 2-Amino-1-(naphthalen-1-yl)ethan-1-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
2-amino-1-naphthalen-1-ylethanol (CAS 23913-55-5) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 2-amino-1-naphthalen-1-ylethanol. InChIKey: FWBOVFYHCSVEKC-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2-amino-1-naphthalen-1-ylethanol |
| InChIKey | FWBOVFYHCSVEKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(CN)O |
Computed by PubChem (NCBI)