CAS 42414-28-8 is the registry number for 4,6,8-Trimethylquinolin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4,6,8-trimethyl-1H-quinolin-2-one (CAS 42414-28-8) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 4,6,8-trimethyl-1H-quinolin-2-one. InChIKey: UHXASMSNKAVYHU-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 4,6,8-trimethyl-1H-quinolin-2-one |
| InChIKey | UHXASMSNKAVYHU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=O)N2)C)C |
Computed by PubChem (NCBI)