CAS 15644-93-6 appears in our catalog under these names: 4-Hydroxy-2,6,8-trimethylquinoline, 95%, 4–Hydroxy–2,6,8–trimethylquinoline, 2,6,8-Trimethylquinolin-4-ol, 99%, 99%, 2,6,8-Trimethylquinolin-4(1H)-one. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g.
2,6,8-trimethyl-1H-quinolin-4-one (CAS 15644-93-6) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 2,6,8-trimethyl-1H-quinolin-4-one. InChIKey: HGONRXDUFLRKDC-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2,6,8-trimethyl-1H-quinolin-4-one |
| InChIKey | HGONRXDUFLRKDC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=O)C=C(N2)C)C |
Computed by PubChem (NCBI)