CAS 2364585-40-8 appears in our catalog under these names: 5-[3-(Propan-2-yl)phenyl]-1,3-oxazole, 95%, 5-[3-(Propan-2-yl)phenyl]-1,3-oxazole, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-(3-propan-2-ylphenyl)-1,3-oxazole (CAS 2364585-40-8) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 5-(3-propan-2-ylphenyl)-1,3-oxazole. InChIKey: KWPWIZYIUPQYMX-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 5-(3-propan-2-ylphenyl)-1,3-oxazole |
| InChIKey | KWPWIZYIUPQYMX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC(=C1)C2=CN=CO2 |
Computed by PubChem (NCBI)