cas: 3080-84-0 — see every product listed under this CAS number, including other names
2,6-Bis(1,1-Dimethylethyl)-4-(Ethoxymethyl)Phenol, 97%, 97% (CAS 3080-84-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1142C5-100mg |
| cas | 3080-84-0 |
| size | 100mg |
| availability | 1.45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1782.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,6-ditert-butyl-4-(ethoxymethyl)phenol (CAS 3080-84-0) is a chemical compound with the molecular formula C17H28O2 and a molecular weight of 264.4 g/mol. IUPAC name: 2,6-ditert-butyl-4-(ethoxymethyl)phenol. InChIKey: UCKUPWJWVMQSKH-UHFFFAOYSA-N.
| Molecular formula | C17H28O2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-(ethoxymethyl)phenol |
| InChIKey | UCKUPWJWVMQSKH-UHFFFAOYSA-N |
| SMILES | CCOCC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)