cas: 128143-88-4 — see every product listed under this CAS number, including other names
2,6-Bis(2-pyridyl)-4(1H)-pyridone 98% (CAS 128143-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A444427-100mg |
| cas | 128143-88-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 414.88 Pln | |
| Ambeed | 5g | 1794.38 Pln | |
| Ambeed | 10g | 2829.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A444427 |
2,6-dipyridin-2-yl-1H-pyridin-4-one (CAS 128143-88-4) is a chemical compound with the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. IUPAC name: 2,6-dipyridin-2-yl-1H-pyridin-4-one. InChIKey: HRORSVNZQWCZTD-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 2,6-dipyridin-2-yl-1H-pyridin-4-one |
| InChIKey | HRORSVNZQWCZTD-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=O)C=C(N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)