cas: 1958100-97-4 — see every product listed under this CAS number, including other names
2,6-Diazaspiro[3.4]octan-7-one toluene-4-sulfonic acid salt, 97%, 97% (CAS 1958100-97-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EISX-100mg |
| cas | 1958100-97-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 923.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,6-diazaspiro[3.4]octan-7-one;4-methylbenzenesulfonic acid (CAS 1958100-97-4) is a chemical compound with the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. IUPAC name: 2,6-diazaspiro[3.4]octan-7-one;4-methylbenzenesulfonic acid. InChIKey: UPALRTYMDUQVSC-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | 2,6-diazaspiro[3.4]octan-7-one;4-methylbenzenesulfonic acid |
| InChIKey | UPALRTYMDUQVSC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1C(=O)NCC12CNC2 |
Computed by PubChem (NCBI)