Products 1040343-07-4
CAS 1040343-07-4 appears in our catalog under these names: 2-Methyl-5-[(4-methylpiperazin-1-yl)sulfonyl]benzoic acid, 95%, 2-MEthyl-5-((4-methylpiperazin-1-yl)sulfonyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-methyl-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid (CAS 1040343-07-4) is a chemical compound with the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. IUPAC name: 2-methyl-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid. InChIKey: SRZJTNSAWYYLAF-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | 2-methyl-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid |
| InChIKey | SRZJTNSAWYYLAF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N2CCN(CC2)C)C(=O)O |
Computed by PubChem (NCBI)