Products 134187-80-7
CAS 134187-80-7 is the registry number for N-Cyclohexyl-4-methyl-3-nitrobenzenesulfonamide, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
N-cyclohexyl-4-methyl-3-nitrobenzenesulfonamide (CAS 134187-80-7) is a chemical compound with the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. IUPAC name: N-cyclohexyl-4-methyl-3-nitrobenzenesulfonamide. InChIKey: MTTBINMZDLWGLQ-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | N-cyclohexyl-4-methyl-3-nitrobenzenesulfonamide |
| InChIKey | MTTBINMZDLWGLQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NC2CCCCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)