CAS 1197193-10-4 appears in our catalog under these names: 2–(4–Methyl–1–piperazinyl)–4–(methylsulfonyl)benzoic Acid, 2-(4-Methyl-1-piperazinyl)-4-(methylsulfonyl)benzoic acid, 95%, 2-(4-Methylpiperazin-1-yl)-4-(methylsulfonyl)benzoic acid, ≥95%, 2-(4-Methyl-1-piperazinyl)-4-(methylsulfonyl)benzoic Acid, ≥95%, ≥95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g.
2-(4-methylpiperazin-1-yl)-4-methylsulfonylbenzoic acid (CAS 1197193-10-4) is a chemical compound with the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)-4-methylsulfonylbenzoic acid. InChIKey: AFDDQQRUJDNNQM-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)-4-methylsulfonylbenzoic acid |
| InChIKey | AFDDQQRUJDNNQM-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=CC(=C2)S(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)