Products 1958100-97-4

CAS 1958100-97-4 appears in our catalog under these names: 2,6-Diazaspiro[3.4]octan-7-one toluene-4-sulfonic acid salt, 97%, 97%, 2,6-Diaza-spiro[3.4]octan-7-one toluene-4-sulfonic acid salt, 98%, 2,6-Diazaspiro[3.4]octan-7-one 4-methylbenzenesulfonate 97%, 2,6-DIAZA-SPIRO[3.4]OCTAN-7-ONE TOLUENE-4-SULFONIC ACID SALT, 97%. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,6-diazaspiro[3.4]octan-7-one;4-methylbenzenesulfonic acid (CAS 1958100-97-4) is a chemical compound with the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. IUPAC name: 2,6-diazaspiro[3.4]octan-7-one;4-methylbenzenesulfonic acid. InChIKey: UPALRTYMDUQVSC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N2O4S
Molecular weight298.36 g/mol
IUPAC name2,6-diazaspiro[3.4]octan-7-one;4-methylbenzenesulfonic acid
InChIKeyUPALRTYMDUQVSC-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)O.C1C(=O)NCC12CNC2

Computed by PubChem (NCBI)