cas: 14401-03-7 — see every product listed under this CAS number, including other names
2,6-Dibromo-3-methyl-4-nitrophenol (CAS 14401-03-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112IRV-1g |
| cas | 14401-03-7 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Chemat | 25g | 2685.20 Pln | |
| Chemat | 250mg | 131.60 Pln |
| delivery time | 3 weeks |
|---|
2,6-dibromo-3-methyl-4-nitrophenol (CAS 14401-03-7) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: 2,6-dibromo-3-methyl-4-nitrophenol. InChIKey: IPHPHFJJKHXWHH-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | 2,6-dibromo-3-methyl-4-nitrophenol |
| InChIKey | IPHPHFJJKHXWHH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1[N+](=O)[O-])Br)O)Br |
Computed by PubChem (NCBI)