CAS 31106-74-8 appears in our catalog under these names: 1,3-Dibromo-2-methoxy-5-nitrobenzene, 98%, 1,3-Dibromo-2-methoxy-5-nitrobenzene. Offered by: Combi-blocks, TRC. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
1,3-dibromo-2-methoxy-5-nitrobenzene (CAS 31106-74-8) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: 1,3-dibromo-2-methoxy-5-nitrobenzene. InChIKey: DXMVGEQBXPPGFL-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | 1,3-dibromo-2-methoxy-5-nitrobenzene |
| InChIKey | DXMVGEQBXPPGFL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)