CAS 14401-03-7 appears in our catalog under these names: 2,6-Dibromo-3-methyl-4-nitrophenol, 95+%, 2,6-Dibromo-3-methyl-4-nitrophenol. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 250mg.
2,6-dibromo-3-methyl-4-nitrophenol (CAS 14401-03-7) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: 2,6-dibromo-3-methyl-4-nitrophenol. InChIKey: IPHPHFJJKHXWHH-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | 2,6-dibromo-3-methyl-4-nitrophenol |
| InChIKey | IPHPHFJJKHXWHH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1[N+](=O)[O-])Br)O)Br |
Computed by PubChem (NCBI)