CAS 1935480-10-6 is the registry number for 2-(3,5-Dibromopyridin-4-yl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-dibromo-4-pyridinyl)-2-hydroxyacetic acid (CAS 1935480-10-6) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: 2-(3,5-dibromo-4-pyridinyl)-2-hydroxyacetic acid. InChIKey: GXJSQXOAFYCNJY-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | 2-(3,5-dibromo-4-pyridinyl)-2-hydroxyacetic acid |
| InChIKey | GXJSQXOAFYCNJY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)C(C(=O)O)O)Br |
Computed by PubChem (NCBI)