CAS 1845690-59-6 appears in our catalog under these names: Methyl 3,5-dibromo-6-hydroxypicolinate, 96%, Methyl 3,5-dibromo-6-hydroxypyridine-2-carboxylate, 96%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 3,5-dibromo-6-oxo-1H-pyridine-2-carboxylate (CAS 1845690-59-6) is a chemical compound with the molecular formula C7H5Br2NO3 and a molecular weight of 310.93 g/mol. IUPAC name: methyl 3,5-dibromo-6-oxo-1H-pyridine-2-carboxylate. InChIKey: PKWUAXJCUBWBHD-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO3 |
|---|---|
| Molecular weight | 310.93 g/mol |
| IUPAC name | methyl 3,5-dibromo-6-oxo-1H-pyridine-2-carboxylate |
| InChIKey | PKWUAXJCUBWBHD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C(=O)N1)Br)Br |
Computed by PubChem (NCBI)