cas: 2484889-02-1 — see every product listed under this CAS number, including other names
2,6-Dibromo-4-isopropylbenzoic acid, 98% (CAS 2484889-02-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1620206-25g |
| cas | 2484889-02-1 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 21566.02 Pln | |
| AmBeed | 10g | 10987.27 Pln | |
| AmBeed | 5g | 6501.88 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,6-dibromo-4-propan-2-ylbenzoic acid (CAS 2484889-02-1) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: 2,6-dibromo-4-propan-2-ylbenzoic acid. InChIKey: PMEJGPKKBPTSOP-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | 2,6-dibromo-4-propan-2-ylbenzoic acid |
| InChIKey | PMEJGPKKBPTSOP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Br)C(=O)O)Br |
Computed by PubChem (NCBI)