Products 10288-11-6
CAS 10288-11-6 appears in our catalog under these names: Benzyl 2,3-dibromopropanoate, 95%, Benzyl 2,3-dibromopropanoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Benzyl 2,3-dibromopropanoate (CAS 10288-11-6) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: benzyl 2,3-dibromopropanoate. InChIKey: DEBQVGQAJKITBG-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | benzyl 2,3-dibromopropanoate |
| InChIKey | DEBQVGQAJKITBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(CBr)Br |
Computed by PubChem (NCBI)