Products 1478503-58-0

CAS 1478503-58-0 is the registry number for Ethyl 3,5-dibromo-4-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3,5-dibromo-4-methylbenzoate (CAS 1478503-58-0) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: ethyl 3,5-dibromo-4-methylbenzoate. InChIKey: PUBRFCQNCOXASI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10Br2O2
Molecular weight321.99 g/mol
IUPAC nameethyl 3,5-dibromo-4-methylbenzoate
InChIKeyPUBRFCQNCOXASI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(C(=C1)Br)C)Br

Computed by PubChem (NCBI)