CAS 1478503-58-0 is the registry number for Ethyl 3,5-dibromo-4-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
Ethyl 3,5-dibromo-4-methylbenzoate (CAS 1478503-58-0) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: ethyl 3,5-dibromo-4-methylbenzoate. InChIKey: PUBRFCQNCOXASI-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | ethyl 3,5-dibromo-4-methylbenzoate |
| InChIKey | PUBRFCQNCOXASI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)Br)C)Br |
Computed by PubChem (NCBI)