CAS 1565049-33-3 appears in our catalog under these names: Ethyl 3,4-dibromo-5-methylbenzoate, 95%, Ethyl 3,4-dibromo-5-methylbenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.
Ethyl 3,4-dibromo-5-methylbenzoate (CAS 1565049-33-3) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: ethyl 3,4-dibromo-5-methylbenzoate. InChIKey: YENIPHULMJRTPI-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | ethyl 3,4-dibromo-5-methylbenzoate |
| InChIKey | YENIPHULMJRTPI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)C)Br)Br |
Computed by PubChem (NCBI)