CAS 2092405-95-1 is the registry number for 2,4-Dibromo-5-(propan-2-yloxy)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,4-dibromo-5-propan-2-yloxybenzaldehyde (CAS 2092405-95-1) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: 2,4-dibromo-5-propan-2-yloxybenzaldehyde. InChIKey: AVXDTLXTJCQFFC-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | 2,4-dibromo-5-propan-2-yloxybenzaldehyde |
| InChIKey | AVXDTLXTJCQFFC-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C(=C1)C=O)Br)Br |
Computed by PubChem (NCBI)