cas: 1823371-33-0 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-(dimethylamino)nicotinaldehyde, 97% (CAS 1823371-33-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A485063-100mg |
| cas | 1823371-33-0 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 265.30 Pln | |
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 1153.78 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,6-dichloro-4-(dimethylamino)pyridine-3-carbaldehyde (CAS 1823371-33-0) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: 2,6-dichloro-4-(dimethylamino)pyridine-3-carbaldehyde. InChIKey: KVTAHBBCANJEDA-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2,6-dichloro-4-(dimethylamino)pyridine-3-carbaldehyde |
| InChIKey | KVTAHBBCANJEDA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=NC(=C1C=O)Cl)Cl |
Computed by PubChem (NCBI)