CAS 731012-08-1 is the registry number for 2-Chloro-n-(5-chloropyridin-2-yl)propanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.
2-chloro-N-(5-chloro-2-pyridinyl)propanamide (CAS 731012-08-1) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: 2-chloro-N-(5-chloro-2-pyridinyl)propanamide. InChIKey: CNAAXGGFJZFRBZ-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2-chloro-N-(5-chloro-2-pyridinyl)propanamide |
| InChIKey | CNAAXGGFJZFRBZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=NC=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)