Products 915949-03-0
CAS 915949-03-0 appears in our catalog under these names: 5,6-Dichloro-n,n-dimethylpyridine-3-carboxamide, 95%, 5,6-Dichloro-N,N-dimethylpyridine-3-carboxamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5,6-dichloro-N,N-dimethylpyridine-3-carboxamide (CAS 915949-03-0) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: 5,6-dichloro-N,N-dimethylpyridine-3-carboxamide. InChIKey: NPXZDWHQMPNDEF-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 5,6-dichloro-N,N-dimethylpyridine-3-carboxamide |
| InChIKey | NPXZDWHQMPNDEF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(N=C1)Cl)Cl |
Computed by PubChem (NCBI)