CAS 1332528-31-0 appears in our catalog under these names: 3-Amino-7-chloro-1,3-dihydro-2h-indol-2-one hydrochloride, 95%, 3-Amino-7-chloroindolin-2-one hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride (CAS 1332528-31-0) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride. InChIKey: DHQZTWWGLTVEDY-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | DHQZTWWGLTVEDY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC(=O)C2N.Cl |
Computed by PubChem (NCBI)