Products 501076-48-8
CAS 501076-48-8 appears in our catalog under these names: 2-Acetamido-4,5-dichloroaniline, 98%, N-(2-Amino-4,5-dichlorophenyl)acetamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
N-(2-amino-4,5-dichlorophenyl)acetamide (CAS 501076-48-8) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: N-(2-amino-4,5-dichlorophenyl)acetamide. InChIKey: RFAVPISRRMQCOS-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | N-(2-amino-4,5-dichlorophenyl)acetamide |
| InChIKey | RFAVPISRRMQCOS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1N)Cl)Cl |
Computed by PubChem (NCBI)