cas: 1428234-45-0 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-isopropylaniline (CAS 1428234-45-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632211-5G |
| cas | 1428234-45-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 3902.81 Pln |
| delivery time | 3-4 weeks |
|---|
2,6-dichloro-4-propan-2-ylaniline (CAS 1428234-45-0) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 2,6-dichloro-4-propan-2-ylaniline. InChIKey: YWZJMEWPEZRBTL-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 2,6-dichloro-4-propan-2-ylaniline |
| InChIKey | YWZJMEWPEZRBTL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Cl)N)Cl |
Computed by PubChem (NCBI)