cas: 20373-58-4 — see every product listed under this CAS number, including other names
2,6-Dichloro-N,N-dimethylisonicotinamide, 97% (CAS 20373-58-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A167888-5g |
| cas | 20373-58-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15980.44 Pln | |
| AmBeed | 1g | 4555.39 Pln | |
| AmBeed | 25g | 53302.27 Pln | |
| AmBeed | 10g | 27151.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,6-dichloro-N,N-dimethylpyridine-4-carboxamide (CAS 20373-58-4) is a chemical compound with the molecular formula C8H8Cl2N2O and a molecular weight of 219.06 g/mol. IUPAC name: 2,6-dichloro-N,N-dimethylpyridine-4-carboxamide. InChIKey: HBFLVNYJAVVALY-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2O |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2,6-dichloro-N,N-dimethylpyridine-4-carboxamide |
| InChIKey | HBFLVNYJAVVALY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=NC(=C1)Cl)Cl |
Computed by PubChem (NCBI)