2,6-Dichlorobenzenesulfonyl chloride, 95%
cas: 6579-54-0 — see every product listed under this CAS number, including other names
2,6-Dichlorobenzenesulfonyl chloride, 95% (CAS 6579-54-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F003583-1G |
| cas | 6579-54-0 |
| size | 1g |
| availability | In Stock UK |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 195.78 Pln | |
| Fluorochem | 25g | 351.98 Pln | |
| Fluorochem | 100g | 695.61 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 798.69 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
2,6-dichlorobenzenesulfonyl chloride (CAS 6579-54-0) is a chemical compound with the molecular formula C6H3Cl3O2S and a molecular weight of 245.5 g/mol. IUPAC name: 2,6-dichlorobenzenesulfonyl chloride. InChIKey: WGGKQIKICKLWGN-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl3O2S |
|---|---|
| Molecular weight | 245.5 g/mol |
| IUPAC name | 2,6-dichlorobenzenesulfonyl chloride |
| InChIKey | WGGKQIKICKLWGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dichlorobenzenesulfonyl chloride, 2,6-dichlorobenzene-1-sulfonyl chloride, 2,6-Dichlorobenzenesulfonylchloride, 2,6-dichlorophenylsulfonyl chloride, 2,6-dichloro-benzenesulfonyl chloride, (2,6-dichlorophenyl)chlorosulfone, 2,6-dichlorobenzenesulfonyl-chloride, Tox21_202863, 2,6-dichlorobenzene-sulfonyl chloride, 2,6-Dichlorobenzenesulfonyl chloride, 97%