Products 6579-54-0
CAS 6579-54-0 appears in our catalog under these names: 2,6–Dichlorobenzenesulfonyl chloride, 2,6-Dichlorobenzenesulfonyl Chloride, >97.0%(GC)(T), 2,6-Dichlorobenzene-1-sulfonyl chloride, 95% , 2,6-Dichlorobenzenesulfonyl chloride 95%, 2,6-DICHLOROBENZENESULFONYL CHLORIDE, 9&. Offered by: GLPBio, TCI, Thermo Scientific, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
2,6-dichlorobenzenesulfonyl chloride (CAS 6579-54-0) is a chemical compound with the molecular formula C6H3Cl3O2S and a molecular weight of 245.5 g/mol. IUPAC name: 2,6-dichlorobenzenesulfonyl chloride. InChIKey: WGGKQIKICKLWGN-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl3O2S |
|---|---|
| Molecular weight | 245.5 g/mol |
| IUPAC name | 2,6-dichlorobenzenesulfonyl chloride |
| InChIKey | WGGKQIKICKLWGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dichlorobenzenesulfonyl chloride, 2,6-dichlorobenzene-1-sulfonyl chloride, 2,6-Dichlorobenzenesulfonylchloride, 2,6-dichlorophenylsulfonyl chloride, 2,6-dichloro-benzenesulfonyl chloride, (2,6-dichlorophenyl)chlorosulfone, 2,6-dichlorobenzenesulfonyl-chloride, Tox21_202863, 2,6-dichlorobenzene-sulfonyl chloride, 2,6-Dichlorobenzenesulfonyl chloride, 97%