CAS 82417-45-6 appears in our catalog under these names: 2,3–Dichlorobenzenesulfonyl chloride, 2,3-Dichlorobenzenesulfonyl chloride/ 98%, 2,3-Dichlorobenzenesulfonyl chloride, 98% , 2,3-Dichlorobenzenesulfonyl Chloride, >96.0%(GC)(T), 2,3-Dichlorobenzenesulfonyl chloride 95%. Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 10g, 1g.
2,3-dichlorobenzenesulfonyl chloride (CAS 82417-45-6) is a chemical compound with the molecular formula C6H3Cl3O2S and a molecular weight of 245.5 g/mol. IUPAC name: 2,3-dichlorobenzenesulfonyl chloride. InChIKey: PQODWTNHDKDHIW-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl3O2S |
|---|---|
| Molecular weight | 245.5 g/mol |
| IUPAC name | 2,3-dichlorobenzenesulfonyl chloride |
| InChIKey | PQODWTNHDKDHIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)